C15H23NO3 — CID 114510480
4-(2,5-dimethoxyphenyl)-3-ethylpiperidin-4-ol (PubChem CID 114510480) has the molecular formula C15H23NO3 and a molecular weight of 265.35 g/mol. Its IUPAC name is 4-(2,5-dimethoxyphenyl)-3-ethylpiperidin-4-ol.
| Compound Name | 4-(2,5-dimethoxyphenyl)-3-ethylpiperidin-4-ol |
|---|---|
| PubChem CID | 114510480 |
| Molecular Formula | C15H23NO3 |
| Molecular Weight | 265.35 g/mol |
| Exact Mass | 265.17 |
| IUPAC Name | 4-(2,5-dimethoxyphenyl)-3-ethylpiperidin-4-ol |
| SMILES | CCC1CNCCC1(O)c1cc(OC)ccc1OC |
| InChI | InChI=1S/C15H23NO3/c1-4-11-10-16-8-7-15(11,17)13-9-12(18-2)5-6-14(13)19-3/h5-6,9,11,16-17H,4,7-8,10H2,1-3H3 |
| InChIKey | TVLSERKJPUXFMO-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.35 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |