C16H23NO2 — CID 131660291
1-ethoxy-5-methoxyspiro[1,2-dihydroindene-3,4'-piperidine] (PubChem CID 131660291) has the molecular formula C16H23NO2 and a molecular weight of 261.36 g/mol. Its IUPAC name is 1-ethoxy-5-methoxyspiro[1,2-dihydroindene-3,4'-piperidine].
| Compound Name | 1-ethoxy-5-methoxyspiro[1,2-dihydroindene-3,4'-piperidine] |
|---|---|
| PubChem CID | 131660291 |
| Molecular Formula | C16H23NO2 |
| Molecular Weight | 261.36 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | 1-ethoxy-5-methoxyspiro[1,2-dihydroindene-3,4'-piperidine] |
| SMILES | CCOC1CC2(CCNCC2)c2cc(OC)ccc21 |
| InChI | InChI=1S/C16H23NO2/c1-3-19-15-11-16(6-8-17-9-7-16)14-10-12(18-2)4-5-13(14)15/h4-5,10,15,17H,3,6-9,11H2,1-2H3 |
| InChIKey | QAPXFDYCDHRZKV-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.36 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |