C23H34O5 — CID 102284910
methyl (1S)-5-[[(1R,2S,4aS,8aS)-1,2,4a-trimethyl-5-methylidene-3,4,6,7,8,8a-hexahydro-2H-naphthalen-1-yl]methyl]-1-hydroxy-3-methoxy-4-oxocyclopent-2-ene-1-carboxylate (PubChem CID 102284910) has the molecular formula C23H34O5 and a molecular weight of 390.52 g/mol. Its IUPAC name is methyl (1S)-5-[[(1R,2S,4aS,8aS)-1,2,4a-trimethyl-5-methylidene-3,4,6,7,8,8a-hexahydro-2H-naphthalen-1-yl]methyl]-1-hydroxy-3-methoxy-4-oxocyclopent-2-ene-1-carboxylate.
| Compound Name | methyl (1S)-5-[[(1R,2S,4aS,8aS)-1,2,4a-trimethyl-5-methylidene-3,4,6,7,8,8a-hexahydro-2H-naphthalen-1-yl]methyl]-1-hydroxy-3-methoxy-4-oxocyclopent-2-ene-1-carboxylate |
|---|---|
| PubChem CID | 102284910 |
| Molecular Formula | C23H34O5 |
| Molecular Weight | 390.52 g/mol |
| Exact Mass | 390.24 |
| IUPAC Name | methyl (1S)-5-[[(1R,2S,4aS,8aS)-1,2,4a-trimethyl-5-methylidene-3,4,6,7,8,8a-hexahydro-2H-naphthalen-1-yl]methyl]-1-hydroxy-3-methoxy-4-oxocyclopent-2-ene-1-carboxylate |
| SMILES | C=C1CCC[C@H]2[C@](C)(CC3C(=O)C(OC)=C[C@@]3(O)C(=O)OC)[C@@H](C)CC[C@]12C |
| InChI | InChI=1S/C23H34O5/c1-14-8-7-9-18-21(14,3)11-10-15(2)22(18,4)12-16-19(24)17(27-5)13-23(16,26)20(25)28-6/h13,15-16,18,26H,1,7-12H2,2-6H3/t15-,16?,18+,21+,22+,23-/m0/s1 |
| InChIKey | HKQNJGSYDWBDNF-PFFXPXKESA-N |
| XLogP | 3.81 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.52 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|