C21H30O2 — CID 122363828
(4aR,10aR)-5,7-dimethoxy-1,4a-dimethyl-1-[(E)-prop-1-enyl]-2,3,4,9,10,10a-hexahydrophenanthrene (PubChem CID 122363828) has the molecular formula C21H30O2 and a molecular weight of 314.47 g/mol. Its IUPAC name is (4aR,10aR)-5,7-dimethoxy-1,4a-dimethyl-1-[(E)-prop-1-enyl]-2,3,4,9,10,10a-hexahydrophenanthrene.
| Compound Name | (4aR,10aR)-5,7-dimethoxy-1,4a-dimethyl-1-[(E)-prop-1-enyl]-2,3,4,9,10,10a-hexahydrophenanthrene |
|---|---|
| PubChem CID | 122363828 |
| Molecular Formula | C21H30O2 |
| Molecular Weight | 314.47 g/mol |
| Exact Mass | 314.22 |
| IUPAC Name | (4aR,10aR)-5,7-dimethoxy-1,4a-dimethyl-1-[(E)-prop-1-enyl]-2,3,4,9,10,10a-hexahydrophenanthrene |
| SMILES | C/C=C/C1(C)CCC[C@@]2(C)c3c(cc(OC)cc3OC)CC[C@H]12 |
| InChI | InChI=1S/C21H30O2/c1-6-10-20(2)11-7-12-21(3)18(20)9-8-15-13-16(22-4)14-17(23-5)19(15)21/h6,10,13-14,18H,7-9,11-12H2,1-5H3/b10-6+/t18-,20?,21-/m1/s1 |
| InChIKey | WRVLJVLGGIFKOH-RVRMFDQGSA-N |
| XLogP | 5.29 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.47 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|