C29H42O6 — CID 163039554
[(1S,2S,4aR,5R,8aR)-5-[(4-hydroxy-5,6-dimethyl-2-oxopyran-3-yl)methyl]-1-[(3S)-3-hydroxy-4-methylpent-4-enyl]-1,4a-dimethyl-6-methylidene-3,4,5,7,8,8a-hexahydro-2H-naphthalen-2-yl] acetate (PubChem CID 163039554) has the molecular formula C29H42O6 and a molecular weight of 486.65 g/mol. Its IUPAC name is [(1S,2S,4aR,5R,8aR)-5-[(4-hydroxy-5,6-dimethyl-2-oxopyran-3-yl)methyl]-1-[(3S)-3-hydroxy-4-methylpent-4-enyl]-1,4a-dimethyl-6-methylidene-3,4,5,7,8,8a-hexahydro-2H-naphthalen-2-yl] acetate.
| Compound Name | [(1S,2S,4aR,5R,8aR)-5-[(4-hydroxy-5,6-dimethyl-2-oxopyran-3-yl)methyl]-1-[(3S)-3-hydroxy-4-methylpent-4-enyl]-1,4a-dimethyl-6-methylidene-3,4,5,7,8,8a-hexahydro-2H-naphthalen-2-yl] acetate |
|---|---|
| PubChem CID | 163039554 |
| Molecular Formula | C29H42O6 |
| Molecular Weight | 486.65 g/mol |
| Exact Mass | 486.30 |
| IUPAC Name | [(1S,2S,4aR,5R,8aR)-5-[(4-hydroxy-5,6-dimethyl-2-oxopyran-3-yl)methyl]-1-[(3S)-3-hydroxy-4-methylpent-4-enyl]-1,4a-dimethyl-6-methylidene-3,4,5,7,8,8a-hexahydro-2H-naphthalen-2-yl] acetate |
| SMILES | C=C1CC[C@H]2[C@](C)(CC[C@H](O)C(=C)C)[C@@H](OC(C)=O)CC[C@]2(C)[C@@H]1Cc1c(O)c(C)c(C)oc1=O |
| InChI | InChI=1S/C29H42O6/c1-16(2)23(31)11-13-29(8)24-10-9-17(3)22(28(24,7)14-12-25(29)35-20(6)30)15-21-26(32)18(4)19(5)34-27(21)33/h22-25,31-32H,1,3,9-15H2,2,4-8H3/t22-,23+,24-,25+,28-,29+/m1/s1 |
| InChIKey | UCNIKIQFSZAFQI-GEMPJMHSSA-N |
| XLogP | 5.54 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.65 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|