C30H41NO2 — CID 14137873
[5-(1H-indol-3-ylmethyl)-1,4a-dimethyl-6-methylidene-1-(4-methylpent-3-enyl)-3,4,5,7,8,8a-hexahydro-2H-naphthalen-2-yl] acetate (PubChem CID 14137873) has the molecular formula C30H41NO2 and a molecular weight of 447.66 g/mol. Its IUPAC name is [5-(1H-indol-3-ylmethyl)-1,4a-dimethyl-6-methylidene-1-(4-methylpent-3-enyl)-3,4,5,7,8,8a-hexahydro-2H-naphthalen-2-yl] acetate.
| Compound Name | [5-(1H-indol-3-ylmethyl)-1,4a-dimethyl-6-methylidene-1-(4-methylpent-3-enyl)-3,4,5,7,8,8a-hexahydro-2H-naphthalen-2-yl] acetate |
|---|---|
| PubChem CID | 14137873 |
| Molecular Formula | C30H41NO2 |
| Molecular Weight | 447.66 g/mol |
| Exact Mass | 447.31 |
| IUPAC Name | [5-(1H-indol-3-ylmethyl)-1,4a-dimethyl-6-methylidene-1-(4-methylpent-3-enyl)-3,4,5,7,8,8a-hexahydro-2H-naphthalen-2-yl] acetate |
| SMILES | C=C1CCC2C(C)(CCC=C(C)C)C(OC(C)=O)CCC2(C)C1Cc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C30H41NO2/c1-20(2)10-9-16-30(6)27-14-13-21(3)25(29(27,5)17-15-28(30)33-22(4)32)18-23-19-31-26-12-8-7-11-24(23)26/h7-8,10-12,19,25,27-28,31H,3,9,13-18H2,1-2,4-6H3 |
| InChIKey | OJBRBRWHDYNBPR-UHFFFAOYSA-N |
| XLogP | 7.78 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.66 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|