C27H35BrO4 — CID 163108158
3-[[6-bromo-5,8a-dimethyl-2-methylidene-5-(4-methyl-3-oxopent-4-enyl)-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]methyl]-4-hydroxybenzoic acid (PubChem CID 163108158) has the molecular formula C27H35BrO4 and a molecular weight of 503.48 g/mol. Its IUPAC name is 3-[[6-bromo-5,8a-dimethyl-2-methylidene-5-(4-methyl-3-oxopent-4-enyl)-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]methyl]-4-hydroxybenzoic acid.
| Compound Name | 3-[[6-bromo-5,8a-dimethyl-2-methylidene-5-(4-methyl-3-oxopent-4-enyl)-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]methyl]-4-hydroxybenzoic acid |
|---|---|
| PubChem CID | 163108158 |
| Molecular Formula | C27H35BrO4 |
| Molecular Weight | 503.48 g/mol |
| Exact Mass | 502.17 |
| IUPAC Name | 3-[[6-bromo-5,8a-dimethyl-2-methylidene-5-(4-methyl-3-oxopent-4-enyl)-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]methyl]-4-hydroxybenzoic acid |
| SMILES | C=C(C)C(=O)CCC1(C)C(Br)CCC2(C)C(Cc3cc(C(=O)O)ccc3O)C(=C)CCC12 |
| InChI | InChI=1S/C27H35BrO4/c1-16(2)21(29)10-12-27(5)23-9-6-17(3)20(26(23,4)13-11-24(27)28)15-19-14-18(25(31)32)7-8-22(19)30/h7-8,14,20,23-24,30H,1,3,6,9-13,15H2,2,4-5H3,(H,31,32) |
| InChIKey | DDSAACDWDIVURT-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.48 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|