C26H34Br3ClO — CID 163114338
2,4-dibromo-6-[[6-bromo-5-(3-chloro-4-methylpent-3-enyl)-5,8a-dimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]methyl]phenol (PubChem CID 163114338) has the molecular formula C26H34Br3ClO and a molecular weight of 637.72 g/mol. Its IUPAC name is 2,4-dibromo-6-[[6-bromo-5-(3-chloro-4-methylpent-3-enyl)-5,8a-dimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]methyl]phenol.
| Compound Name | 2,4-dibromo-6-[[6-bromo-5-(3-chloro-4-methylpent-3-enyl)-5,8a-dimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]methyl]phenol |
|---|---|
| PubChem CID | 163114338 |
| Molecular Formula | C26H34Br3ClO |
| Molecular Weight | 637.72 g/mol |
| Exact Mass | 633.98 |
| IUPAC Name | 2,4-dibromo-6-[[6-bromo-5-(3-chloro-4-methylpent-3-enyl)-5,8a-dimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]methyl]phenol |
| SMILES | C=C1CCC2C(C)(CCC(Cl)=C(C)C)C(Br)CCC2(C)C1Cc1cc(Br)cc(Br)c1O |
| InChI | InChI=1S/C26H34Br3ClO/c1-15(2)21(30)8-10-26(5)22-7-6-16(3)19(25(22,4)11-9-23(26)29)13-17-12-18(27)14-20(28)24(17)31/h12,14,19,22-23,31H,3,6-11,13H2,1-2,4-5H3 |
| InChIKey | VFDRWRLRZIENRT-UHFFFAOYSA-N |
| XLogP | 9.92 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.72 |
| LogP ≤ 5 | 9.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|