C20H33BrO — CID 162959702
(3S)-5-[(1S,6R,8aS)-6-bromo-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]-3-methylpent-1-en-3-ol (PubChem CID 162959702) has the molecular formula C20H33BrO and a molecular weight of 369.39 g/mol. Its IUPAC name is (3S)-5-[(1S,6R,8aS)-6-bromo-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]-3-methylpent-1-en-3-ol.
| Compound Name | (3S)-5-[(1S,6R,8aS)-6-bromo-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]-3-methylpent-1-en-3-ol |
|---|---|
| PubChem CID | 162959702 |
| Molecular Formula | C20H33BrO |
| Molecular Weight | 369.39 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | (3S)-5-[(1S,6R,8aS)-6-bromo-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]-3-methylpent-1-en-3-ol |
| SMILES | C=C[C@@](C)(O)CC[C@H]1C(=C)CCC2C(C)(C)[C@H](Br)CC[C@]21C |
| InChI | InChI=1S/C20H33BrO/c1-7-19(5,22)12-10-15-14(2)8-9-16-18(3,4)17(21)11-13-20(15,16)6/h7,15-17,22H,1-2,8-13H2,3-6H3/t15-,16?,17+,19+,20-/m0/s1 |
| InChIKey | OOTTXHPHVJPZLE-CJYOTLLZSA-N |
| XLogP | 5.88 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.39 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|