C15H25BrO — CID 23425299
5-[(3S)-3-bromo-2,2-dimethyl-6-methylidenecyclohexyl]-3-methylpent-1-en-3-ol (PubChem CID 23425299) has the molecular formula C15H25BrO and a molecular weight of 301.27 g/mol. Its IUPAC name is 5-[(3S)-3-bromo-2,2-dimethyl-6-methylidenecyclohexyl]-3-methylpent-1-en-3-ol.
| Compound Name | 5-[(3S)-3-bromo-2,2-dimethyl-6-methylidenecyclohexyl]-3-methylpent-1-en-3-ol |
|---|---|
| PubChem CID | 23425299 |
| Molecular Formula | C15H25BrO |
| Molecular Weight | 301.27 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | 5-[(3S)-3-bromo-2,2-dimethyl-6-methylidenecyclohexyl]-3-methylpent-1-en-3-ol |
| SMILES | C=CC(C)(O)CCC1C(=C)CC[C@H](Br)C1(C)C |
| InChI | InChI=1S/C15H25BrO/c1-6-15(5,17)10-9-12-11(2)7-8-13(16)14(12,3)4/h6,12-13,17H,1-2,7-10H2,3-5H3/t12?,13-,15?/m0/s1 |
| InChIKey | DDROGZIGNULDJY-OWYJLGKBSA-N |
| XLogP | 4.46 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.27 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|