C31H53BrO4 — CID 177441593
4-[(1S,3R)-3-bromo-2,2-dimethyl-6-methylidenecyclohexyl]-2-[(1R,3S,6R,8R,11S,14R)-1,8,13,13,14-pentamethyl-2,7,12-trioxatricyclo[9.5.0.03,8]hexadecan-6-yl]butan-2-ol (PubChem CID 177441593) has the molecular formula C31H53BrO4 and a molecular weight of 569.67 g/mol. Its IUPAC name is 4-[(1S,3R)-3-bromo-2,2-dimethyl-6-methylidenecyclohexyl]-2-[(1R,3S,6R,8R,11S,14R)-1,8,13,13,14-pentamethyl-2,7,12-trioxatricyclo[9.5.0.03,8]hexadecan-6-yl]butan-2-ol.
| Compound Name | 4-[(1S,3R)-3-bromo-2,2-dimethyl-6-methylidenecyclohexyl]-2-[(1R,3S,6R,8R,11S,14R)-1,8,13,13,14-pentamethyl-2,7,12-trioxatricyclo[9.5.0.03,8]hexadecan-6-yl]butan-2-ol |
|---|---|
| PubChem CID | 177441593 |
| Molecular Formula | C31H53BrO4 |
| Molecular Weight | 569.67 g/mol |
| Exact Mass | 568.31 |
| IUPAC Name | 4-[(1S,3R)-3-bromo-2,2-dimethyl-6-methylidenecyclohexyl]-2-[(1R,3S,6R,8R,11S,14R)-1,8,13,13,14-pentamethyl-2,7,12-trioxatricyclo[9.5.0.03,8]hexadecan-6-yl]butan-2-ol |
| SMILES | C=C1CC[C@@H](Br)C(C)(C)[C@H]1CCC(C)(O)[C@H]1CC[C@@H]2O[C@]3(C)CC[C@@H](C)C(C)(C)O[C@H]3CC[C@@]2(C)O1 |
| InChI | InChI=1S/C31H53BrO4/c1-20-10-11-23(32)27(3,4)22(20)15-17-29(7,33)24-12-13-25-31(9,35-24)19-16-26-30(8,36-25)18-14-21(2)28(5,6)34-26/h21-26,33H,1,10-19H2,2-9H3/t21-,22+,23-,24-,25+,26+,29?,30-,31-/m1/s1 |
| InChIKey | RRRWXKCJGKCPQF-IXGJGPPUSA-N |
| XLogP | 7.74 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.67 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|