C20H35BrO3 — CID 162970337
5-[6-bromo-2-(3-hydroxy-3-methylpent-4-enyl)-1-methyl-3-methylidenecyclohexyl]-2-methylpentane-2,3-diol (PubChem CID 162970337) has the molecular formula C20H35BrO3 and a molecular weight of 403.40 g/mol. Its IUPAC name is 5-[6-bromo-2-(3-hydroxy-3-methylpent-4-enyl)-1-methyl-3-methylidenecyclohexyl]-2-methylpentane-2,3-diol.
| Compound Name | 5-[6-bromo-2-(3-hydroxy-3-methylpent-4-enyl)-1-methyl-3-methylidenecyclohexyl]-2-methylpentane-2,3-diol |
|---|---|
| PubChem CID | 162970337 |
| Molecular Formula | C20H35BrO3 |
| Molecular Weight | 403.40 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | 5-[6-bromo-2-(3-hydroxy-3-methylpent-4-enyl)-1-methyl-3-methylidenecyclohexyl]-2-methylpentane-2,3-diol |
| SMILES | C=CC(C)(O)CCC1C(=C)CCC(Br)C1(C)CCC(O)C(C)(C)O |
| InChI | InChI=1S/C20H35BrO3/c1-7-19(5,24)12-10-15-14(2)8-9-16(21)20(15,6)13-11-17(22)18(3,4)23/h7,15-17,22-24H,1-2,8-13H2,3-6H3 |
| InChIKey | MCXOWUJCEYTICG-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.40 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|