C24H38O5 — CID 75179833
4-[[5-(3-hydroxy-3-methylpent-4-enyl)-1,4a-dimethyl-6-methylidene-3,4,5,7,8,8a-hexahydro-2H-naphthalen-1-yl]methoxy]-4-oxobutanoic acid (PubChem CID 75179833) has the molecular formula C24H38O5 and a molecular weight of 406.56 g/mol. Its IUPAC name is 4-[[5-(3-hydroxy-3-methylpent-4-enyl)-1,4a-dimethyl-6-methylidene-3,4,5,7,8,8a-hexahydro-2H-naphthalen-1-yl]methoxy]-4-oxobutanoic acid.
| Compound Name | 4-[[5-(3-hydroxy-3-methylpent-4-enyl)-1,4a-dimethyl-6-methylidene-3,4,5,7,8,8a-hexahydro-2H-naphthalen-1-yl]methoxy]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 75179833 |
| Molecular Formula | C24H38O5 |
| Molecular Weight | 406.56 g/mol |
| Exact Mass | 406.27 |
| IUPAC Name | 4-[[5-(3-hydroxy-3-methylpent-4-enyl)-1,4a-dimethyl-6-methylidene-3,4,5,7,8,8a-hexahydro-2H-naphthalen-1-yl]methoxy]-4-oxobutanoic acid |
| SMILES | C=CC(C)(O)CCC1C(=C)CCC2C(C)(COC(=O)CCC(=O)O)CCCC12C |
| InChI | InChI=1S/C24H38O5/c1-6-23(4,28)15-12-18-17(2)8-9-19-22(3,13-7-14-24(18,19)5)16-29-21(27)11-10-20(25)26/h6,18-19,28H,1-2,7-16H2,3-5H3,(H,25,26) |
| InChIKey | LMGFVRFXNAGVRH-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.56 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|