C29H38O3 — CID 162867400
[(1R,4aS,5R,8aS)-1,4a-dimethyl-6-methylidene-5-(3-methylidenepent-4-enyl)-3,4,5,7,8,8a-hexahydro-2H-naphthalen-1-yl]methyl 3-(4-hydroxyphenyl)prop-2-enoate (PubChem CID 162867400) has the molecular formula C29H38O3 and a molecular weight of 434.62 g/mol. Its IUPAC name is [(1R,4aS,5R,8aS)-1,4a-dimethyl-6-methylidene-5-(3-methylidenepent-4-enyl)-3,4,5,7,8,8a-hexahydro-2H-naphthalen-1-yl]methyl 3-(4-hydroxyphenyl)prop-2-enoate.
| Compound Name | [(1R,4aS,5R,8aS)-1,4a-dimethyl-6-methylidene-5-(3-methylidenepent-4-enyl)-3,4,5,7,8,8a-hexahydro-2H-naphthalen-1-yl]methyl 3-(4-hydroxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 162867400 |
| Molecular Formula | C29H38O3 |
| Molecular Weight | 434.62 g/mol |
| Exact Mass | 434.28 |
| IUPAC Name | [(1R,4aS,5R,8aS)-1,4a-dimethyl-6-methylidene-5-(3-methylidenepent-4-enyl)-3,4,5,7,8,8a-hexahydro-2H-naphthalen-1-yl]methyl 3-(4-hydroxyphenyl)prop-2-enoate |
| SMILES | C=CC(=C)CC[C@@H]1C(=C)CC[C@@H]2[C@](C)(COC(=O)C=Cc3ccc(O)cc3)CCC[C@@]12C |
| InChI | InChI=1S/C29H38O3/c1-6-21(2)8-15-25-22(3)9-16-26-28(4,18-7-19-29(25,26)5)20-32-27(31)17-12-23-10-13-24(30)14-11-23/h6,10-14,17,25-26,30H,1-3,7-9,15-16,18-20H2,4-5H3/t25-,26-,28+,29+/m1/s1 |
| InChIKey | LOUZXPCOHWEXGD-KFADFNFCSA-N |
| XLogP | 7.25 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.62 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|