C26H40O6 — CID 163030775
4-O-[[5-(5-methoxy-3-methyl-5-oxopent-3-enyl)-1,4a-dimethyl-6-methylidene-3,4,5,7,8,8a-hexahydro-2H-naphthalen-1-yl]methyl] 1-O-methyl butanedioate (PubChem CID 163030775) has the molecular formula C26H40O6 and a molecular weight of 448.60 g/mol. Its IUPAC name is 4-O-[[5-(5-methoxy-3-methyl-5-oxopent-3-enyl)-1,4a-dimethyl-6-methylidene-3,4,5,7,8,8a-hexahydro-2H-naphthalen-1-yl]methyl] 1-O-methyl butanedioate.
| Compound Name | 4-O-[[5-(5-methoxy-3-methyl-5-oxopent-3-enyl)-1,4a-dimethyl-6-methylidene-3,4,5,7,8,8a-hexahydro-2H-naphthalen-1-yl]methyl] 1-O-methyl butanedioate |
|---|---|
| PubChem CID | 163030775 |
| Molecular Formula | C26H40O6 |
| Molecular Weight | 448.60 g/mol |
| Exact Mass | 448.28 |
| IUPAC Name | 4-O-[[5-(5-methoxy-3-methyl-5-oxopent-3-enyl)-1,4a-dimethyl-6-methylidene-3,4,5,7,8,8a-hexahydro-2H-naphthalen-1-yl]methyl] 1-O-methyl butanedioate |
| SMILES | C=C1CCC2C(C)(COC(=O)CCC(=O)OC)CCCC2(C)C1CCC(C)=CC(=O)OC |
| InChI | InChI=1S/C26H40O6/c1-18(16-24(29)31-6)8-10-20-19(2)9-11-21-25(3,14-7-15-26(20,21)4)17-32-23(28)13-12-22(27)30-5/h16,20-21H,2,7-15,17H2,1,3-6H3 |
| InChIKey | UTSHJHGOFCOBMA-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.60 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|