C28H39NO — CID 163031641
(1R,4bR,7R,8S,10aS)-8-(1H-indol-3-ylmethyl)-1,4b,7,8,10a-pentamethyl-1,3,4,4a,5,6,7,8a,9,10-decahydrophenanthren-2-one (PubChem CID 163031641) has the molecular formula C28H39NO and a molecular weight of 405.63 g/mol. Its IUPAC name is (1R,4bR,7R,8S,10aS)-8-(1H-indol-3-ylmethyl)-1,4b,7,8,10a-pentamethyl-1,3,4,4a,5,6,7,8a,9,10-decahydrophenanthren-2-one.
| Compound Name | (1R,4bR,7R,8S,10aS)-8-(1H-indol-3-ylmethyl)-1,4b,7,8,10a-pentamethyl-1,3,4,4a,5,6,7,8a,9,10-decahydrophenanthren-2-one |
|---|---|
| PubChem CID | 163031641 |
| Molecular Formula | C28H39NO |
| Molecular Weight | 405.63 g/mol |
| Exact Mass | 405.30 |
| IUPAC Name | (1R,4bR,7R,8S,10aS)-8-(1H-indol-3-ylmethyl)-1,4b,7,8,10a-pentamethyl-1,3,4,4a,5,6,7,8a,9,10-decahydrophenanthren-2-one |
| SMILES | C[C@@H]1CC[C@@]2(C)C3CCC(=O)[C@H](C)[C@@]3(C)CCC2[C@@]1(C)Cc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C28H39NO/c1-18-12-14-27(4)24-11-10-23(30)19(2)26(24,3)15-13-25(27)28(18,5)16-20-17-29-22-9-7-6-8-21(20)22/h6-9,17-19,24-25,29H,10-16H2,1-5H3/t18-,19+,24?,25?,26-,27+,28+/m1/s1 |
| InChIKey | ZEETTZHRLKVSNU-VRSSECOSSA-N |
| XLogP | 7.18 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.63 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |