C31H38N2O2 — CID 11431364
2-[[(1R,2S,4aS,8aS)-1,2,4a,5-tetramethyl-2,3,4,7,8,8a-hexahydronaphthalen-1-yl]methyl]-6-[2-(1H-indol-3-yl)ethylamino]cyclohexa-2,5-diene-1,4-dione (PubChem CID 11431364) has the molecular formula C31H38N2O2 and a molecular weight of 470.66 g/mol. Its IUPAC name is 2-[[(1R,2S,4aS,8aS)-1,2,4a,5-tetramethyl-2,3,4,7,8,8a-hexahydronaphthalen-1-yl]methyl]-6-[2-(1H-indol-3-yl)ethylamino]cyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2-[[(1R,2S,4aS,8aS)-1,2,4a,5-tetramethyl-2,3,4,7,8,8a-hexahydronaphthalen-1-yl]methyl]-6-[2-(1H-indol-3-yl)ethylamino]cyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 11431364 |
| Molecular Formula | C31H38N2O2 |
| Molecular Weight | 470.66 g/mol |
| Exact Mass | 470.29 |
| IUPAC Name | 2-[[(1R,2S,4aS,8aS)-1,2,4a,5-tetramethyl-2,3,4,7,8,8a-hexahydronaphthalen-1-yl]methyl]-6-[2-(1H-indol-3-yl)ethylamino]cyclohexa-2,5-diene-1,4-dione |
| SMILES | CC1=CCC[C@H]2[C@](C)(CC3=CC(=O)C=C(NCCc4c[nH]c5ccccc45)C3=O)[C@@H](C)CC[C@]12C |
| InChI | InChI=1S/C31H38N2O2/c1-20-8-7-11-28-30(20,3)14-12-21(2)31(28,4)18-23-16-24(34)17-27(29(23)35)32-15-13-22-19-33-26-10-6-5-9-25(22)26/h5-6,8-10,16-17,19,21,28,32-33H,7,11-15,18H2,1-4H3/t21-,28+,30+,31+/m0/s1 |
| InChIKey | MKTQANUVGKCBKR-YQBCZVNCSA-N |
| XLogP | 6.45 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.66 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|