C28H37NO2 — CID 102383475
[(1S,8R,8aR)-8-(1H-indol-3-ylmethyl)-7-methylidene-8a-(4-methylpent-3-enyl)-1,2,3,4,4a,5,6,8-octahydronaphthalen-1-yl] acetate (PubChem CID 102383475) has the molecular formula C28H37NO2 and a molecular weight of 419.61 g/mol. Its IUPAC name is [(1S,8R,8aR)-8-(1H-indol-3-ylmethyl)-7-methylidene-8a-(4-methylpent-3-enyl)-1,2,3,4,4a,5,6,8-octahydronaphthalen-1-yl] acetate.
| Compound Name | [(1S,8R,8aR)-8-(1H-indol-3-ylmethyl)-7-methylidene-8a-(4-methylpent-3-enyl)-1,2,3,4,4a,5,6,8-octahydronaphthalen-1-yl] acetate |
|---|---|
| PubChem CID | 102383475 |
| Molecular Formula | C28H37NO2 |
| Molecular Weight | 419.61 g/mol |
| Exact Mass | 419.28 |
| IUPAC Name | [(1S,8R,8aR)-8-(1H-indol-3-ylmethyl)-7-methylidene-8a-(4-methylpent-3-enyl)-1,2,3,4,4a,5,6,8-octahydronaphthalen-1-yl] acetate |
| SMILES | C=C1CCC2CCC[C@H](OC(C)=O)[C@@]2(CCC=C(C)C)[C@@H]1Cc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C28H37NO2/c1-19(2)9-8-16-28-23(10-7-13-27(28)31-21(4)30)15-14-20(3)25(28)17-22-18-29-26-12-6-5-11-24(22)26/h5-6,9,11-12,18,23,25,27,29H,3,7-8,10,13-17H2,1-2,4H3/t23?,25-,27+,28-/m1/s1 |
| InChIKey | WBHLXJJLLQTETG-WDUMIWSNSA-N |
| XLogP | 7.14 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.61 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|