C31H45NO2 — CID 71745531
3-[(2E,6E)-3,7-dimethyl-9-[(4R,5S)-2,2,5-trimethyl-5-(4-methylpent-3-enyl)-1,3-dioxolan-4-yl]nona-2,6-dienyl]-1H-indole (PubChem CID 71745531) has the molecular formula C31H45NO2 and a molecular weight of 463.71 g/mol. Its IUPAC name is 3-[(2E,6E)-3,7-dimethyl-9-[(4R,5S)-2,2,5-trimethyl-5-(4-methylpent-3-enyl)-1,3-dioxolan-4-yl]nona-2,6-dienyl]-1H-indole.
| Compound Name | 3-[(2E,6E)-3,7-dimethyl-9-[(4R,5S)-2,2,5-trimethyl-5-(4-methylpent-3-enyl)-1,3-dioxolan-4-yl]nona-2,6-dienyl]-1H-indole |
|---|---|
| PubChem CID | 71745531 |
| Molecular Formula | C31H45NO2 |
| Molecular Weight | 463.71 g/mol |
| Exact Mass | 463.35 |
| IUPAC Name | 3-[(2E,6E)-3,7-dimethyl-9-[(4R,5S)-2,2,5-trimethyl-5-(4-methylpent-3-enyl)-1,3-dioxolan-4-yl]nona-2,6-dienyl]-1H-indole |
| SMILES | CC(C)=CCC[C@]1(C)OC(C)(C)O[C@@H]1CC/C(C)=C/CC/C(C)=C/Cc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C31H45NO2/c1-23(2)12-11-21-31(7)29(33-30(5,6)34-31)20-18-25(4)14-10-13-24(3)17-19-26-22-32-28-16-9-8-15-27(26)28/h8-9,12,14-17,22,29,32H,10-11,13,18-21H2,1-7H3/b24-17+,25-14+/t29-,31+/m1/s1 |
| InChIKey | NIQFRBVISXUTQT-BUVXNQGGSA-N |
| XLogP | 8.82 |
| TPSA | 34.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.71 |
| LogP ≤ 5 | 8.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|