C20H28N2 — CID 92525977
(2Z)-N-[2-(1H-indol-3-yl)ethyl]-3,7-dimethylocta-2,6-dien-1-amine (PubChem CID 92525977) has the molecular formula C20H28N2 and a molecular weight of 296.46 g/mol. Its IUPAC name is (2Z)-N-[2-(1H-indol-3-yl)ethyl]-3,7-dimethylocta-2,6-dien-1-amine.
| Compound Name | (2Z)-N-[2-(1H-indol-3-yl)ethyl]-3,7-dimethylocta-2,6-dien-1-amine |
|---|---|
| PubChem CID | 92525977 |
| Molecular Formula | C20H28N2 |
| Molecular Weight | 296.46 g/mol |
| Exact Mass | 296.23 |
| IUPAC Name | (2Z)-N-[2-(1H-indol-3-yl)ethyl]-3,7-dimethylocta-2,6-dien-1-amine |
| SMILES | CC(C)=CCC/C(C)=C\CNCCc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C20H28N2/c1-16(2)7-6-8-17(3)11-13-21-14-12-18-15-22-20-10-5-4-9-19(18)20/h4-5,7,9-11,15,21-22H,6,8,12-14H2,1-3H3/b17-11- |
| InChIKey | YENZYGJEKHJGEY-BOPFTXTBSA-N |
| XLogP | 4.99 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.46 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|