C21H28N2O — CID 70154649
N-[(2E)-3,7-dimethylocta-2,6-dienyl]-3-(1H-indol-3-yl)propanamide (PubChem CID 70154649) has the molecular formula C21H28N2O and a molecular weight of 324.47 g/mol. Its IUPAC name is N-[(2E)-3,7-dimethylocta-2,6-dienyl]-3-(1H-indol-3-yl)propanamide.
| Compound Name | N-[(2E)-3,7-dimethylocta-2,6-dienyl]-3-(1H-indol-3-yl)propanamide |
|---|---|
| PubChem CID | 70154649 |
| Molecular Formula | C21H28N2O |
| Molecular Weight | 324.47 g/mol |
| Exact Mass | 324.22 |
| IUPAC Name | N-[(2E)-3,7-dimethylocta-2,6-dienyl]-3-(1H-indol-3-yl)propanamide |
| SMILES | CC(C)=CCC/C(C)=C/CNC(=O)CCc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C21H28N2O/c1-16(2)7-6-8-17(3)13-14-22-21(24)12-11-18-15-23-20-10-5-4-9-19(18)20/h4-5,7,9-10,13,15,23H,6,8,11-12,14H2,1-3H3,(H,22,24)/b17-13+ |
| InChIKey | MACRBBRVTVNBAI-GHRIWEEISA-N |
| XLogP | 4.91 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.47 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|