C23H31NO — CID 85292216
3-[9-(3,3-dimethyloxiran-2-yl)-3,7-dimethylnona-2,6-dienyl]-1H-indole (PubChem CID 85292216) has the molecular formula C23H31NO and a molecular weight of 337.51 g/mol. Its IUPAC name is 3-[9-(3,3-dimethyloxiran-2-yl)-3,7-dimethylnona-2,6-dienyl]-1H-indole.
| Compound Name | 3-[9-(3,3-dimethyloxiran-2-yl)-3,7-dimethylnona-2,6-dienyl]-1H-indole |
|---|---|
| PubChem CID | 85292216 |
| Molecular Formula | C23H31NO |
| Molecular Weight | 337.51 g/mol |
| Exact Mass | 337.24 |
| IUPAC Name | 3-[9-(3,3-dimethyloxiran-2-yl)-3,7-dimethylnona-2,6-dienyl]-1H-indole |
| SMILES | CC(=CCc1c[nH]c2ccccc12)CCC=C(C)CCC1OC1(C)C |
| InChI | InChI=1S/C23H31NO/c1-17(8-7-9-18(2)13-15-22-23(3,4)25-22)12-14-19-16-24-21-11-6-5-10-20(19)21/h5-6,9-12,16,22,24H,7-8,13-15H2,1-4H3 |
| InChIKey | BIIIFRMIOHESGY-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 28.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.51 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|