C29H45NO3Si — CID 101253753
[(2S,3S)-3-[(3E,7E)-9-[1-[tert-butyl(dimethyl)silyl]oxyindol-3-yl]-3,7-dimethylnona-3,7-dienyl]-2-methyloxiran-2-yl]methanol (PubChem CID 101253753) has the molecular formula C29H45NO3Si and a molecular weight of 483.77 g/mol. Its IUPAC name is [(2S,3S)-3-[(3E,7E)-9-[1-[tert-butyl(dimethyl)silyl]oxyindol-3-yl]-3,7-dimethylnona-3,7-dienyl]-2-methyloxiran-2-yl]methanol.
| Compound Name | [(2S,3S)-3-[(3E,7E)-9-[1-[tert-butyl(dimethyl)silyl]oxyindol-3-yl]-3,7-dimethylnona-3,7-dienyl]-2-methyloxiran-2-yl]methanol |
|---|---|
| PubChem CID | 101253753 |
| Molecular Formula | C29H45NO3Si |
| Molecular Weight | 483.77 g/mol |
| Exact Mass | 483.32 |
| IUPAC Name | [(2S,3S)-3-[(3E,7E)-9-[1-[tert-butyl(dimethyl)silyl]oxyindol-3-yl]-3,7-dimethylnona-3,7-dienyl]-2-methyloxiran-2-yl]methanol |
| SMILES | C/C(=C\Cc1cn(O[Si](C)(C)C(C)(C)C)c2ccccc12)CC/C=C(\C)CC[C@@H]1O[C@@]1(C)CO |
| InChI | InChI=1S/C29H45NO3Si/c1-22(12-11-13-23(2)17-19-27-29(6,21-31)32-27)16-18-24-20-30(26-15-10-9-14-25(24)26)33-34(7,8)28(3,4)5/h9-10,13-16,20,27,31H,11-12,17-19,21H2,1-8H3/b22-16+,23-13+/t27-,29-/m0/s1 |
| InChIKey | KYDLBMKTHAXZAW-YPZOGVJCSA-N |
| XLogP | 7.22 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.77 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|