C22H30O4 — CID 44518437
phenyl (E)-6-[(2R,3R)-3-[2-[(2R)-3,3-dimethyloxiran-2-yl]ethyl]-3-methyloxiran-2-yl]-4-methylhex-3-enoate (PubChem CID 44518437) has the molecular formula C22H30O4 and a molecular weight of 358.48 g/mol. Its IUPAC name is phenyl (E)-6-[(2R,3R)-3-[2-[(2R)-3,3-dimethyloxiran-2-yl]ethyl]-3-methyloxiran-2-yl]-4-methylhex-3-enoate.
| Compound Name | phenyl (E)-6-[(2R,3R)-3-[2-[(2R)-3,3-dimethyloxiran-2-yl]ethyl]-3-methyloxiran-2-yl]-4-methylhex-3-enoate |
|---|---|
| PubChem CID | 44518437 |
| Molecular Formula | C22H30O4 |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.21 |
| IUPAC Name | phenyl (E)-6-[(2R,3R)-3-[2-[(2R)-3,3-dimethyloxiran-2-yl]ethyl]-3-methyloxiran-2-yl]-4-methylhex-3-enoate |
| SMILES | C/C(=C\CC(=O)Oc1ccccc1)CC[C@H]1O[C@]1(C)CC[C@H]1OC1(C)C |
| InChI | InChI=1S/C22H30O4/c1-16(11-13-20(23)24-17-8-6-5-7-9-17)10-12-19-22(4,26-19)15-14-18-21(2,3)25-18/h5-9,11,18-19H,10,12-15H2,1-4H3/b16-11+/t18-,19-,22-/m1/s1 |
| InChIKey | VEEUIGYSVSQALB-FRMBZEGZSA-N |
| XLogP | 4.82 |
| TPSA | 51.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|