C22H32O4S — CID 44518292
(2R,3R)-2-[2-[(2R)-3,3-dimethyloxiran-2-yl]ethyl]-2-methyl-3-[(E)-3-methyl-5-(4-methylphenyl)sulfonylpent-3-enyl]oxirane (PubChem CID 44518292) has the molecular formula C22H32O4S and a molecular weight of 392.56 g/mol. Its IUPAC name is (2R,3R)-2-[2-[(2R)-3,3-dimethyloxiran-2-yl]ethyl]-2-methyl-3-[(E)-3-methyl-5-(4-methylphenyl)sulfonylpent-3-enyl]oxirane.
| Compound Name | (2R,3R)-2-[2-[(2R)-3,3-dimethyloxiran-2-yl]ethyl]-2-methyl-3-[(E)-3-methyl-5-(4-methylphenyl)sulfonylpent-3-enyl]oxirane |
|---|---|
| PubChem CID | 44518292 |
| Molecular Formula | C22H32O4S |
| Molecular Weight | 392.56 g/mol |
| Exact Mass | 392.20 |
| IUPAC Name | (2R,3R)-2-[2-[(2R)-3,3-dimethyloxiran-2-yl]ethyl]-2-methyl-3-[(E)-3-methyl-5-(4-methylphenyl)sulfonylpent-3-enyl]oxirane |
| SMILES | C/C(=C\CS(=O)(=O)c1ccc(C)cc1)CC[C@H]1O[C@]1(C)CC[C@H]1OC1(C)C |
| InChI | InChI=1S/C22H32O4S/c1-16-6-9-18(10-7-16)27(23,24)15-13-17(2)8-11-20-22(5,26-20)14-12-19-21(3,4)25-19/h6-7,9-10,13,19-20H,8,11-12,14-15H2,1-5H3/b17-13+/t19-,20-,22-/m1/s1 |
| InChIKey | LHNODXUCWKJEJW-BEBPLPAWSA-N |
| XLogP | 4.61 |
| TPSA | 59.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.56 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|