C30H48O3 — CID 162861821
10-hydroxy-1,2,6a,6b,9,9,12a-heptamethyl-2,3,4,5,6,6a,7,8,8a,10,11,12,14a,14b-tetradecahydro-1H-picene-4a-carboxylic acid (PubChem CID 162861821) has the molecular formula C30H48O3 and a molecular weight of 456.71 g/mol. Its IUPAC name is 10-hydroxy-1,2,6a,6b,9,9,12a-heptamethyl-2,3,4,5,6,6a,7,8,8a,10,11,12,14a,14b-tetradecahydro-1H-picene-4a-carboxylic acid.
| Compound Name | 10-hydroxy-1,2,6a,6b,9,9,12a-heptamethyl-2,3,4,5,6,6a,7,8,8a,10,11,12,14a,14b-tetradecahydro-1H-picene-4a-carboxylic acid |
|---|---|
| PubChem CID | 162861821 |
| Molecular Formula | C30H48O3 |
| Molecular Weight | 456.71 g/mol |
| Exact Mass | 456.36 |
| IUPAC Name | 10-hydroxy-1,2,6a,6b,9,9,12a-heptamethyl-2,3,4,5,6,6a,7,8,8a,10,11,12,14a,14b-tetradecahydro-1H-picene-4a-carboxylic acid |
| SMILES | CC1CCC2(C(=O)O)CCC3(C)C(C=CC4C5(C)CCC(O)C(C)(C)C5CCC43C)C2C1C |
| InChI | InChI=1S/C30H48O3/c1-18-10-15-30(25(32)33)17-16-28(6)20(24(30)19(18)2)8-9-22-27(5)13-12-23(31)26(3,4)21(27)11-14-29(22,28)7/h8-9,18-24,31H,10-17H2,1-7H3,(H,32,33) |
| InChIKey | PLSAJKYPRJGMHO-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.71 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|