C30H50O5 — CID 162944423
10,14,14a-trihydroxy-1,2,6a,6b,9,9,12a-heptamethyl-1,2,3,4,5,6,6a,7,8,8a,10,11,12,13,14,14b-hexadecahydropicene-4a-carboxylic acid (PubChem CID 162944423) has the molecular formula C30H50O5 and a molecular weight of 490.73 g/mol. Its IUPAC name is 10,14,14a-trihydroxy-1,2,6a,6b,9,9,12a-heptamethyl-1,2,3,4,5,6,6a,7,8,8a,10,11,12,13,14,14b-hexadecahydropicene-4a-carboxylic acid.
| Compound Name | 10,14,14a-trihydroxy-1,2,6a,6b,9,9,12a-heptamethyl-1,2,3,4,5,6,6a,7,8,8a,10,11,12,13,14,14b-hexadecahydropicene-4a-carboxylic acid |
|---|---|
| PubChem CID | 162944423 |
| Molecular Formula | C30H50O5 |
| Molecular Weight | 490.73 g/mol |
| Exact Mass | 490.37 |
| IUPAC Name | 10,14,14a-trihydroxy-1,2,6a,6b,9,9,12a-heptamethyl-1,2,3,4,5,6,6a,7,8,8a,10,11,12,13,14,14b-hexadecahydropicene-4a-carboxylic acid |
| SMILES | CC1CCC2(C(=O)O)CCC3(C)C4(C)CCC5C(C)(C)C(O)CCC5(C)C4CC(O)C3(O)C2C1C |
| InChI | InChI=1S/C30H50O5/c1-17-8-13-29(24(33)34)15-14-28(7)27(6)12-9-19-25(3,4)21(31)10-11-26(19,5)20(27)16-22(32)30(28,35)23(29)18(17)2/h17-23,31-32,35H,8-16H2,1-7H3,(H,33,34) |
| InChIKey | JFEDUPNXIYCJAV-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.73 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |