C32H58O4 — CID 143880885
(6bS)-8a-(hydroxymethyl)-4,4,6a,6b,11,11,14b-heptamethyl-2,3,4a,5,6,7,8,9,10,12,12a,13,14,14a-tetradecahydro-1H-picene-3,6a,13-triol;ethane (PubChem CID 143880885) has the molecular formula C32H58O4 and a molecular weight of 506.81 g/mol. Its IUPAC name is (6bS)-8a-(hydroxymethyl)-4,4,6a,6b,11,11,14b-heptamethyl-2,3,4a,5,6,7,8,9,10,12,12a,13,14,14a-tetradecahydro-1H-picene-3,6a,13-triol;ethane.
| Compound Name | (6bS)-8a-(hydroxymethyl)-4,4,6a,6b,11,11,14b-heptamethyl-2,3,4a,5,6,7,8,9,10,12,12a,13,14,14a-tetradecahydro-1H-picene-3,6a,13-triol;ethane |
|---|---|
| PubChem CID | 143880885 |
| Molecular Formula | C32H58O4 |
| Molecular Weight | 506.81 g/mol |
| Exact Mass | 506.43 |
| IUPAC Name | (6bS)-8a-(hydroxymethyl)-4,4,6a,6b,11,11,14b-heptamethyl-2,3,4a,5,6,7,8,9,10,12,12a,13,14,14a-tetradecahydro-1H-picene-3,6a,13-triol;ethane |
| SMILES | CC.CC1(C)CCC2(CO)CC[C@@]3(C)C4(C)CCC5C(C)(C)C(O)CCC5(C)C4CC(O)C3(O)C2C1 |
| InChI | InChI=1S/C30H52O4.C2H6/c1-24(2)12-14-29(18-31)15-13-28(7)27(6)11-8-19-25(3,4)22(32)9-10-26(19,5)20(27)16-23(33)30(28,34)21(29)17-24;1-2/h19-23,31-34H,8-18H2,1-7H3;1-2H3/t19?,20?,21?,22?,23?,26?,27?,28-,29?,30?;/m0./s1 |
| InChIKey | LHKWKDQZMUMFDZ-RSXYAFGFSA-N |
| XLogP | 6.33 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.81 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |