C30H52O3 — CID 25028111
(3R,6aR,6bR,8aS,13S,14bR)-8a-(hydroxymethyl)-4,4,6a,6b,11,11,14b-heptamethyl-1,2,3,4a,5,6,6a,7,8,9,10,12,12a,13,14,14a-hexadecahydropicene-3,13-diol (PubChem CID 25028111) has the molecular formula C30H52O3 and a molecular weight of 460.74 g/mol. Its IUPAC name is (3R,6aR,6bR,8aS,13S,14bR)-8a-(hydroxymethyl)-4,4,6a,6b,11,11,14b-heptamethyl-1,2,3,4a,5,6,6a,7,8,9,10,12,12a,13,14,14a-hexadecahydropicene-3,13-diol.
| Compound Name | (3R,6aR,6bR,8aS,13S,14bR)-8a-(hydroxymethyl)-4,4,6a,6b,11,11,14b-heptamethyl-1,2,3,4a,5,6,6a,7,8,9,10,12,12a,13,14,14a-hexadecahydropicene-3,13-diol |
|---|---|
| PubChem CID | 25028111 |
| Molecular Formula | C30H52O3 |
| Molecular Weight | 460.74 g/mol |
| Exact Mass | 460.39 |
| IUPAC Name | (3R,6aR,6bR,8aS,13S,14bR)-8a-(hydroxymethyl)-4,4,6a,6b,11,11,14b-heptamethyl-1,2,3,4a,5,6,6a,7,8,9,10,12,12a,13,14,14a-hexadecahydropicene-3,13-diol |
| SMILES | CC1(C)CC[C@]2(CO)CC[C@]3(C)C(C(O)CC4[C@@]5(C)CC[C@@H](O)C(C)(C)C5CC[C@]43C)C2C1 |
| InChI | InChI=1S/C30H52O3/c1-25(2)12-14-30(18-31)15-13-29(7)24(19(30)17-25)20(32)16-22-27(5)10-9-23(33)26(3,4)21(27)8-11-28(22,29)6/h19-24,31-33H,8-18H2,1-7H3/t19?,20?,21?,22?,23-,24?,27+,28-,29-,30-/m1/s1 |
| InChIKey | DJPXQGGSIIDFGE-ARLBMATHSA-N |
| XLogP | 6.19 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.74 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |