C30H48O3 — CID 162938852
(1S,3aS,5aR,5bR,7aR,9S,11aR,11bR,13aS,13bR)-1,9-dihydroxy-3a,5a,5b,8,8,11a-hexamethyl-1-prop-1-en-2-yl-2,3,4,5,6,7,7a,9,10,11,11b,12,13a,13b-tetradecahydrocyclopenta[a]chrysen-13-one (PubChem CID 162938852) has the molecular formula C30H48O3 and a molecular weight of 456.71 g/mol. Its IUPAC name is (1S,3aS,5aR,5bR,7aR,9S,11aR,11bR,13aS,13bR)-1,9-dihydroxy-3a,5a,5b,8,8,11a-hexamethyl-1-prop-1-en-2-yl-2,3,4,5,6,7,7a,9,10,11,11b,12,13a,13b-tetradecahydrocyclopenta[a]chrysen-13-one.
| Compound Name | (1S,3aS,5aR,5bR,7aR,9S,11aR,11bR,13aS,13bR)-1,9-dihydroxy-3a,5a,5b,8,8,11a-hexamethyl-1-prop-1-en-2-yl-2,3,4,5,6,7,7a,9,10,11,11b,12,13a,13b-tetradecahydrocyclopenta[a]chrysen-13-one |
|---|---|
| PubChem CID | 162938852 |
| Molecular Formula | C30H48O3 |
| Molecular Weight | 456.71 g/mol |
| Exact Mass | 456.36 |
| IUPAC Name | (1S,3aS,5aR,5bR,7aR,9S,11aR,11bR,13aS,13bR)-1,9-dihydroxy-3a,5a,5b,8,8,11a-hexamethyl-1-prop-1-en-2-yl-2,3,4,5,6,7,7a,9,10,11,11b,12,13a,13b-tetradecahydrocyclopenta[a]chrysen-13-one |
| SMILES | C=C(C)[C@]1(O)CC[C@]2(C)CC[C@]3(C)[C@@H](C(=O)C[C@@H]4[C@@]5(C)CC[C@H](O)C(C)(C)[C@@H]5CC[C@]43C)[C@H]21 |
| InChI | InChI=1S/C30H48O3/c1-18(2)30(33)16-14-26(5)13-15-29(8)23(24(26)30)19(31)17-21-27(6)11-10-22(32)25(3,4)20(27)9-12-28(21,29)7/h20-24,32-33H,1,9-17H2,2-8H3/t20-,21+,22-,23-,24+,26-,27-,28+,29+,30+/m0/s1 |
| InChIKey | GLJDNMFMXKXNHP-FSRAZMSWSA-N |
| XLogP | 6.32 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.71 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|