C31H45NO3 — CID 70692995
(1R,2R,13R,14R,17S,20R)-2,9,9,13,14-pentamethyl-20-prop-1-en-2-yl-7-oxa-6-azahexacyclo[11.11.0.02,10.04,8.014,22.017,21]tetracosa-4(8),5-diene-17-carboxylic acid (PubChem CID 70692995) has the molecular formula C31H45NO3 and a molecular weight of 479.71 g/mol. Its IUPAC name is (1R,2R,13R,14R,17S,20R)-2,9,9,13,14-pentamethyl-20-prop-1-en-2-yl-7-oxa-6-azahexacyclo[11.11.0.02,10.04,8.014,22.017,21]tetracosa-4(8),5-diene-17-carboxylic acid.
| Compound Name | (1R,2R,13R,14R,17S,20R)-2,9,9,13,14-pentamethyl-20-prop-1-en-2-yl-7-oxa-6-azahexacyclo[11.11.0.02,10.04,8.014,22.017,21]tetracosa-4(8),5-diene-17-carboxylic acid |
|---|---|
| PubChem CID | 70692995 |
| Molecular Formula | C31H45NO3 |
| Molecular Weight | 479.71 g/mol |
| Exact Mass | 479.34 |
| IUPAC Name | (1R,2R,13R,14R,17S,20R)-2,9,9,13,14-pentamethyl-20-prop-1-en-2-yl-7-oxa-6-azahexacyclo[11.11.0.02,10.04,8.014,22.017,21]tetracosa-4(8),5-diene-17-carboxylic acid |
| SMILES | C=C(C)C1CC[C@]2(C(=O)O)CC[C@]3(C)C(CC[C@@H]4[C@@]5(C)Cc6cnoc6C(C)(C)C5CC[C@]43C)C12 |
| InChI | InChI=1S/C31H45NO3/c1-18(2)20-10-13-31(26(33)34)15-14-29(6)21(24(20)31)8-9-23-28(5)16-19-17-32-35-25(19)27(3,4)22(28)11-12-30(23,29)7/h17,20-24H,1,8-16H2,2-7H3,(H,33,34)/t20?,21?,22?,23-,24?,28+,29-,30-,31+/m1/s1 |
| InChIKey | NIBNFSKXUCTRGP-TTWMNMDLSA-N |
| XLogP | 7.43 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.71 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|