C32H47NO2S — CID 53472588
(2R,13R,14R,17S,20R)-2,6,9,9,13,14-hexamethyl-20-prop-1-en-2-yl-7-thia-5-azahexacyclo[11.11.0.02,10.04,8.014,22.017,21]tetracosa-4(8),5-diene-17-carboxylic acid (PubChem CID 53472588) has the molecular formula C32H47NO2S and a molecular weight of 509.80 g/mol. Its IUPAC name is (2R,13R,14R,17S,20R)-2,6,9,9,13,14-hexamethyl-20-prop-1-en-2-yl-7-thia-5-azahexacyclo[11.11.0.02,10.04,8.014,22.017,21]tetracosa-4(8),5-diene-17-carboxylic acid.
| Compound Name | (2R,13R,14R,17S,20R)-2,6,9,9,13,14-hexamethyl-20-prop-1-en-2-yl-7-thia-5-azahexacyclo[11.11.0.02,10.04,8.014,22.017,21]tetracosa-4(8),5-diene-17-carboxylic acid |
|---|---|
| PubChem CID | 53472588 |
| Molecular Formula | C32H47NO2S |
| Molecular Weight | 509.80 g/mol |
| Exact Mass | 509.33 |
| IUPAC Name | (2R,13R,14R,17S,20R)-2,6,9,9,13,14-hexamethyl-20-prop-1-en-2-yl-7-thia-5-azahexacyclo[11.11.0.02,10.04,8.014,22.017,21]tetracosa-4(8),5-diene-17-carboxylic acid |
| SMILES | C=C(C)C1CC[C@]2(C(=O)O)CC[C@]3(C)C(CCC4[C@@]5(C)Cc6nc(C)sc6C(C)(C)C5CC[C@]43C)C12 |
| InChI | InChI=1S/C32H47NO2S/c1-18(2)20-11-14-32(27(34)35)16-15-30(7)21(25(20)32)9-10-24-29(6)17-22-26(36-19(3)33-22)28(4,5)23(29)12-13-31(24,30)8/h20-21,23-25H,1,9-17H2,2-8H3,(H,34,35)/t20?,21?,23?,24?,25?,29-,30+,31+,32-/m0/s1 |
| InChIKey | QXMDTALZYCTSAB-QVVCRHRASA-N |
| XLogP | 8.21 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.80 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|