C32H49N3O3 — CID 164616635
(1R,2R,10R,13R,14R,17S,20R,21R,22R)-7-(2-hydroxyethyl)-2,9,9,13,14-pentamethyl-20-prop-1-en-2-yl-5,6,7-triazahexacyclo[11.11.0.02,10.04,8.014,22.017,21]tetracosa-4(8),5-diene-17-carboxylic acid (PubChem CID 164616635) has the molecular formula C32H49N3O3 and a molecular weight of 523.76 g/mol. Its IUPAC name is (1R,2R,10R,13R,14R,17S,20R,21R,22R)-7-(2-hydroxyethyl)-2,9,9,13,14-pentamethyl-20-prop-1-en-2-yl-5,6,7-triazahexacyclo[11.11.0.02,10.04,8.014,22.017,21]tetracosa-4(8),5-diene-17-carboxylic acid.
| Compound Name | (1R,2R,10R,13R,14R,17S,20R,21R,22R)-7-(2-hydroxyethyl)-2,9,9,13,14-pentamethyl-20-prop-1-en-2-yl-5,6,7-triazahexacyclo[11.11.0.02,10.04,8.014,22.017,21]tetracosa-4(8),5-diene-17-carboxylic acid |
|---|---|
| PubChem CID | 164616635 |
| Molecular Formula | C32H49N3O3 |
| Molecular Weight | 523.76 g/mol |
| Exact Mass | 523.38 |
| IUPAC Name | (1R,2R,10R,13R,14R,17S,20R,21R,22R)-7-(2-hydroxyethyl)-2,9,9,13,14-pentamethyl-20-prop-1-en-2-yl-5,6,7-triazahexacyclo[11.11.0.02,10.04,8.014,22.017,21]tetracosa-4(8),5-diene-17-carboxylic acid |
| SMILES | C=C(C)[C@@H]1CC[C@]2(C(=O)O)CC[C@]3(C)[C@H](CC[C@@H]4[C@@]5(C)Cc6nnn(CCO)c6C(C)(C)[C@@H]5CC[C@]43C)[C@@H]12 |
| InChI | InChI=1S/C32H49N3O3/c1-19(2)20-10-13-32(27(37)38)15-14-30(6)21(25(20)32)8-9-24-29(5)18-22-26(35(16-17-36)34-33-22)28(3,4)23(29)11-12-31(24,30)7/h20-21,23-25,36H,1,8-18H2,2-7H3,(H,37,38)/t20-,21+,23-,24+,25+,29-,30+,31+,32-/m0/s1 |
| InChIKey | VYXOPIWYWCOBIE-JOQCCHAVSA-N |
| XLogP | 6.03 |
| TPSA | 88.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.76 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|