C37H51NO2 — CID 42617848
(2R,17R,18R,21S)-2,11,13,13,17,18-hexamethyl-24-prop-1-en-2-yl-11-azaheptacyclo[15.11.0.02,14.04,12.05,10.018,26.021,25]octacosa-4(12),5,7,9-tetraene-21-carboxylic acid (PubChem CID 42617848) has the molecular formula C37H51NO2 and a molecular weight of 541.82 g/mol. Its IUPAC name is (2R,17R,18R,21S)-2,11,13,13,17,18-hexamethyl-24-prop-1-en-2-yl-11-azaheptacyclo[15.11.0.02,14.04,12.05,10.018,26.021,25]octacosa-4(12),5,7,9-tetraene-21-carboxylic acid.
| Compound Name | (2R,17R,18R,21S)-2,11,13,13,17,18-hexamethyl-24-prop-1-en-2-yl-11-azaheptacyclo[15.11.0.02,14.04,12.05,10.018,26.021,25]octacosa-4(12),5,7,9-tetraene-21-carboxylic acid |
|---|---|
| PubChem CID | 42617848 |
| Molecular Formula | C37H51NO2 |
| Molecular Weight | 541.82 g/mol |
| Exact Mass | 541.39 |
| IUPAC Name | (2R,17R,18R,21S)-2,11,13,13,17,18-hexamethyl-24-prop-1-en-2-yl-11-azaheptacyclo[15.11.0.02,14.04,12.05,10.018,26.021,25]octacosa-4(12),5,7,9-tetraene-21-carboxylic acid |
| SMILES | C=C(C)C1CC[C@]2(C(=O)O)CC[C@]3(C)C(CCC4[C@@]5(C)Cc6c(n(C)c7ccccc67)C(C)(C)C5CC[C@]43C)C12 |
| InChI | InChI=1S/C37H51NO2/c1-22(2)23-15-18-37(32(39)40)20-19-35(6)26(30(23)37)13-14-29-34(5)21-25-24-11-9-10-12-27(24)38(8)31(25)33(3,4)28(34)16-17-36(29,35)7/h9-12,23,26,28-30H,1,13-21H2,2-8H3,(H,39,40)/t23?,26?,28?,29?,30?,34-,35+,36+,37-/m0/s1 |
| InChIKey | PTOSZFYITDVBIQ-FJNJAAGISA-N |
| XLogP | 8.93 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.82 |
| LogP ≤ 5 | 8.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|