C35H48O4 — CID 171153665
(1R,5aR,5bR,11aR)-10-(furan-2-ylmethylidene)-5a,5b,8,8,11a-pentamethyl-9-oxo-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,11,11b,12,13,13a,13b-tetradecahydrocyclopenta[a]chrysene-3a-carboxylic acid (PubChem CID 171153665) has the molecular formula C35H48O4 and a molecular weight of 532.77 g/mol. Its IUPAC name is (1R,5aR,5bR,11aR)-10-(furan-2-ylmethylidene)-5a,5b,8,8,11a-pentamethyl-9-oxo-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,11,11b,12,13,13a,13b-tetradecahydrocyclopenta[a]chrysene-3a-carboxylic acid.
| Compound Name | (1R,5aR,5bR,11aR)-10-(furan-2-ylmethylidene)-5a,5b,8,8,11a-pentamethyl-9-oxo-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,11,11b,12,13,13a,13b-tetradecahydrocyclopenta[a]chrysene-3a-carboxylic acid |
|---|---|
| PubChem CID | 171153665 |
| Molecular Formula | C35H48O4 |
| Molecular Weight | 532.77 g/mol |
| Exact Mass | 532.36 |
| IUPAC Name | (1R,5aR,5bR,11aR)-10-(furan-2-ylmethylidene)-5a,5b,8,8,11a-pentamethyl-9-oxo-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,11,11b,12,13,13a,13b-tetradecahydrocyclopenta[a]chrysene-3a-carboxylic acid |
| SMILES | C=C(C)C1CCC2(C(=O)O)CC[C@]3(C)C(CCC4[C@@]5(C)CC(=Cc6ccco6)C(=O)C(C)(C)C5CC[C@]43C)C12 |
| InChI | InChI=1S/C35H48O4/c1-21(2)24-12-15-35(30(37)38)17-16-33(6)25(28(24)35)10-11-27-32(5)20-22(19-23-9-8-18-39-23)29(36)31(3,4)26(32)13-14-34(27,33)7/h8-9,18-19,24-28H,1,10-17,20H2,2-7H3,(H,37,38)/t24?,25?,26?,27?,28?,32-,33+,34+,35?/m0/s1 |
| InChIKey | OAZAZBRWAMEGCZ-PYHNOGTHSA-N |
| XLogP | 8.58 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.77 |
| LogP ≤ 5 | 8.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|