C36H54N2O2S — CID 155516799
(1R,2R,10R,13R,14R,17S,20R,21R,22R)-2,9,9,13,14-pentamethyl-6-piperidin-1-yl-20-prop-1-en-2-yl-5-thia-7-azahexacyclo[11.11.0.02,10.04,8.014,22.017,21]tetracosa-4(8),6-diene-17-carboxylic acid (PubChem CID 155516799) has the molecular formula C36H54N2O2S and a molecular weight of 578.91 g/mol. Its IUPAC name is (1R,2R,10R,13R,14R,17S,20R,21R,22R)-2,9,9,13,14-pentamethyl-6-piperidin-1-yl-20-prop-1-en-2-yl-5-thia-7-azahexacyclo[11.11.0.02,10.04,8.014,22.017,21]tetracosa-4(8),6-diene-17-carboxylic acid.
| Compound Name | (1R,2R,10R,13R,14R,17S,20R,21R,22R)-2,9,9,13,14-pentamethyl-6-piperidin-1-yl-20-prop-1-en-2-yl-5-thia-7-azahexacyclo[11.11.0.02,10.04,8.014,22.017,21]tetracosa-4(8),6-diene-17-carboxylic acid |
|---|---|
| PubChem CID | 155516799 |
| Molecular Formula | C36H54N2O2S |
| Molecular Weight | 578.91 g/mol |
| Exact Mass | 578.39 |
| IUPAC Name | (1R,2R,10R,13R,14R,17S,20R,21R,22R)-2,9,9,13,14-pentamethyl-6-piperidin-1-yl-20-prop-1-en-2-yl-5-thia-7-azahexacyclo[11.11.0.02,10.04,8.014,22.017,21]tetracosa-4(8),6-diene-17-carboxylic acid |
| SMILES | C=C(C)[C@@H]1CC[C@]2(C(=O)O)CC[C@]3(C)[C@H](CC[C@@H]4[C@@]5(C)Cc6sc(N7CCCCC7)nc6C(C)(C)[C@@H]5CC[C@]43C)[C@@H]12 |
| InChI | InChI=1S/C36H54N2O2S/c1-22(2)23-13-16-36(30(39)40)18-17-34(6)24(28(23)36)11-12-27-33(5)21-25-29(32(3,4)26(33)14-15-35(27,34)7)37-31(41-25)38-19-9-8-10-20-38/h23-24,26-28H,1,8-21H2,2-7H3,(H,39,40)/t23-,24+,26-,27+,28+,33-,34+,35+,36-/m0/s1 |
| InChIKey | CSZNMIKHYVLNBN-ISICGHPISA-N |
| XLogP | 8.89 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.91 |
| LogP ≤ 5 | 8.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|