C31H45N5O2 — CID 143880580
1,8,8,15,22,22-hexamethyl-5-(2-methyltetrazol-5-yl)-20-oxa-19-azahexacyclo[12.11.0.02,11.05,10.015,23.017,21]pentacosa-17(21),18-dien-12-one (PubChem CID 143880580) has the molecular formula C31H45N5O2 and a molecular weight of 519.73 g/mol. Its IUPAC name is 1,8,8,15,22,22-hexamethyl-5-(2-methyltetrazol-5-yl)-20-oxa-19-azahexacyclo[12.11.0.02,11.05,10.015,23.017,21]pentacosa-17(21),18-dien-12-one.
| Compound Name | 1,8,8,15,22,22-hexamethyl-5-(2-methyltetrazol-5-yl)-20-oxa-19-azahexacyclo[12.11.0.02,11.05,10.015,23.017,21]pentacosa-17(21),18-dien-12-one |
|---|---|
| PubChem CID | 143880580 |
| Molecular Formula | C31H45N5O2 |
| Molecular Weight | 519.73 g/mol |
| Exact Mass | 519.36 |
| IUPAC Name | 1,8,8,15,22,22-hexamethyl-5-(2-methyltetrazol-5-yl)-20-oxa-19-azahexacyclo[12.11.0.02,11.05,10.015,23.017,21]pentacosa-17(21),18-dien-12-one |
| SMILES | Cn1nnc(C23CCC4C(C(=O)CC5C4(C)CCC4C(C)(C)c6oncc6CC45C)C2CC(C)(C)CC3)n1 |
| InChI | InChI=1S/C31H45N5O2/c1-27(2)12-13-31(26-33-35-36(7)34-26)11-8-19-24(20(31)16-27)21(37)14-23-29(19,5)10-9-22-28(3,4)25-18(17-32-38-25)15-30(22,23)6/h17,19-20,22-24H,8-16H2,1-7H3 |
| InChIKey | BZWYMJHLWNQQMY-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 86.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.73 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |