C34H51F3N2O3 — CID 143880629
ethane;1,8,8,16,23,23-hexamethyl-N-(2,2,2-trifluoroethyl)-12,21-dioxa-20-azaheptacyclo[13.11.0.02,11.05,10.011,13.016,24.018,22]hexacosa-18(22),19-diene-5-carboxamide (PubChem CID 143880629) has the molecular formula C34H51F3N2O3 and a molecular weight of 592.79 g/mol. Its IUPAC name is ethane;1,8,8,16,23,23-hexamethyl-N-(2,2,2-trifluoroethyl)-12,21-dioxa-20-azaheptacyclo[13.11.0.02,11.05,10.011,13.016,24.018,22]hexacosa-18(22),19-diene-5-carboxamide.
| Compound Name | ethane;1,8,8,16,23,23-hexamethyl-N-(2,2,2-trifluoroethyl)-12,21-dioxa-20-azaheptacyclo[13.11.0.02,11.05,10.011,13.016,24.018,22]hexacosa-18(22),19-diene-5-carboxamide |
|---|---|
| PubChem CID | 143880629 |
| Molecular Formula | C34H51F3N2O3 |
| Molecular Weight | 592.79 g/mol |
| Exact Mass | 592.39 |
| IUPAC Name | ethane;1,8,8,16,23,23-hexamethyl-N-(2,2,2-trifluoroethyl)-12,21-dioxa-20-azaheptacyclo[13.11.0.02,11.05,10.011,13.016,24.018,22]hexacosa-18(22),19-diene-5-carboxamide |
| SMILES | CC.CC1(C)CCC2(C(=O)NCC(F)(F)F)CCC3C4(C)CCC5C(C)(C)c6oncc6CC5(C)C4CC4OC43C2C1 |
| InChI | InChI=1S/C32H45F3N2O3.C2H6/c1-26(2)11-12-30(25(38)36-17-31(33,34)35)10-8-20-28(5)9-7-19-27(3,4)24-18(16-37-40-24)14-29(19,6)21(28)13-23-32(20,39-23)22(30)15-26;1-2/h16,19-23H,7-15,17H2,1-6H3,(H,36,38);1-2H3 |
| InChIKey | TYKGGQHKSAHDFI-UHFFFAOYSA-N |
| XLogP | 8.02 |
| TPSA | 67.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.79 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|