C32H48N2O4 — CID 143880610
ethane;methyl (14E)-11-cyano-14-hydroxyimino-2,2,6b,9,12a-pentamethyl-10-oxo-1,3,4,5,6,6a,6a,7,8,8a,9,13,14a,14b-tetradecahydropicene-4a-carboxylate (PubChem CID 143880610) has the molecular formula C32H48N2O4 and a molecular weight of 524.75 g/mol. Its IUPAC name is ethane;methyl (14E)-11-cyano-14-hydroxyimino-2,2,6b,9,12a-pentamethyl-10-oxo-1,3,4,5,6,6a,6a,7,8,8a,9,13,14a,14b-tetradecahydropicene-4a-carboxylate.
| Compound Name | ethane;methyl (14E)-11-cyano-14-hydroxyimino-2,2,6b,9,12a-pentamethyl-10-oxo-1,3,4,5,6,6a,6a,7,8,8a,9,13,14a,14b-tetradecahydropicene-4a-carboxylate |
|---|---|
| PubChem CID | 143880610 |
| Molecular Formula | C32H48N2O4 |
| Molecular Weight | 524.75 g/mol |
| Exact Mass | 524.36 |
| IUPAC Name | ethane;methyl (14E)-11-cyano-14-hydroxyimino-2,2,6b,9,12a-pentamethyl-10-oxo-1,3,4,5,6,6a,6a,7,8,8a,9,13,14a,14b-tetradecahydropicene-4a-carboxylate |
| SMILES | CC.COC(=O)C12CCC3C(/C(=N/O)CC4C5(C)C=C(C#N)C(=O)C(C)C5CCC34C)C1CC(C)(C)CC2 |
| InChI | InChI=1S/C30H42N2O4.C2H6/c1-17-19-7-9-28(4)20-8-10-30(26(34)36-6)12-11-27(2,3)15-21(30)24(20)22(32-35)13-23(28)29(19,5)14-18(16-31)25(17)33;1-2/h14,17,19-21,23-24,35H,7-13,15H2,1-6H3;1-2H3/b32-22+; |
| InChIKey | NPJOLCQHKVVLLO-BMFJENFKSA-N |
| XLogP | 6.97 |
| TPSA | 99.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.75 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|