C29H43NO — CID 143880615
4,6a,8a,11,11,14b-hexamethyl-3-oxo-4a,5,6,6a,6b,7,8,9,10,12,12a,13,14,14a-tetradecahydro-4H-picene-2-carbonitrile (PubChem CID 143880615) has the molecular formula C29H43NO and a molecular weight of 421.67 g/mol. Its IUPAC name is 4,6a,8a,11,11,14b-hexamethyl-3-oxo-4a,5,6,6a,6b,7,8,9,10,12,12a,13,14,14a-tetradecahydro-4H-picene-2-carbonitrile.
| Compound Name | 4,6a,8a,11,11,14b-hexamethyl-3-oxo-4a,5,6,6a,6b,7,8,9,10,12,12a,13,14,14a-tetradecahydro-4H-picene-2-carbonitrile |
|---|---|
| PubChem CID | 143880615 |
| Molecular Formula | C29H43NO |
| Molecular Weight | 421.67 g/mol |
| Exact Mass | 421.33 |
| IUPAC Name | 4,6a,8a,11,11,14b-hexamethyl-3-oxo-4a,5,6,6a,6b,7,8,9,10,12,12a,13,14,14a-tetradecahydro-4H-picene-2-carbonitrile |
| SMILES | CC1C(=O)C(C#N)=CC2(C)C1CCC1(C)C3CCC4(C)CCC(C)(C)CC4C3CCC21 |
| InChI | InChI=1S/C29H43NO/c1-18-21-10-12-28(5)22-9-11-27(4)14-13-26(2,3)16-23(27)20(22)7-8-24(28)29(21,6)15-19(17-30)25(18)31/h15,18,20-24H,7-14,16H2,1-6H3 |
| InChIKey | YLJMDXGNMKBGPM-UHFFFAOYSA-N |
| XLogP | 7.35 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.67 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |