C31H45NO2 — CID 163761172
(4S,4aS,8R,8aR)-8-[2-[(2S,4aR)-2-ethenyl-2,4a,7,7-tetramethyl-3,4,5,6,8,8a-hexahydro-1H-naphthalen-1-yl]-2-oxoethyl]-4,8a-dimethyl-3-oxo-4,4a,5,6,7,8-hexahydronaphthalene-2-carbonitrile (PubChem CID 163761172) has the molecular formula C31H45NO2 and a molecular weight of 463.71 g/mol. Its IUPAC name is (4S,4aS,8R,8aR)-8-[2-[(2S,4aR)-2-ethenyl-2,4a,7,7-tetramethyl-3,4,5,6,8,8a-hexahydro-1H-naphthalen-1-yl]-2-oxoethyl]-4,8a-dimethyl-3-oxo-4,4a,5,6,7,8-hexahydronaphthalene-2-carbonitrile.
| Compound Name | (4S,4aS,8R,8aR)-8-[2-[(2S,4aR)-2-ethenyl-2,4a,7,7-tetramethyl-3,4,5,6,8,8a-hexahydro-1H-naphthalen-1-yl]-2-oxoethyl]-4,8a-dimethyl-3-oxo-4,4a,5,6,7,8-hexahydronaphthalene-2-carbonitrile |
|---|---|
| PubChem CID | 163761172 |
| Molecular Formula | C31H45NO2 |
| Molecular Weight | 463.71 g/mol |
| Exact Mass | 463.35 |
| IUPAC Name | (4S,4aS,8R,8aR)-8-[2-[(2S,4aR)-2-ethenyl-2,4a,7,7-tetramethyl-3,4,5,6,8,8a-hexahydro-1H-naphthalen-1-yl]-2-oxoethyl]-4,8a-dimethyl-3-oxo-4,4a,5,6,7,8-hexahydronaphthalene-2-carbonitrile |
| SMILES | C=C[C@]1(C)CC[C@@]2(C)CCC(C)(C)CC2C1C(=O)C[C@H]1CCC[C@H]2[C@H](C)C(=O)C(C#N)=C[C@]12C |
| InChI | InChI=1S/C31H45NO2/c1-8-29(5)14-15-30(6)13-12-28(3,4)18-24(30)26(29)25(33)16-22-10-9-11-23-20(2)27(34)21(19-32)17-31(22,23)7/h8,17,20,22-24,26H,1,9-16,18H2,2-7H3/t20-,22+,23-,24?,26?,29+,30+,31+/m0/s1 |
| InChIKey | LYHYBAQHTQQLPT-XYMLUIEBSA-N |
| XLogP | 7.47 |
| TPSA | 57.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.71 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|