C32H46N2O4 — CID 46184213
methyl (1R,2S,5S,15R,16R,21R)-18-cyano-1,2,8,8,16,20,20-heptamethyl-13,19-dioxo-12-azapentacyclo[13.8.0.02,11.05,10.016,21]tricos-17-ene-5-carboxylate (PubChem CID 46184213) has the molecular formula C32H46N2O4 and a molecular weight of 522.73 g/mol. Its IUPAC name is methyl (1R,2S,5S,15R,16R,21R)-18-cyano-1,2,8,8,16,20,20-heptamethyl-13,19-dioxo-12-azapentacyclo[13.8.0.02,11.05,10.016,21]tricos-17-ene-5-carboxylate.
| Compound Name | methyl (1R,2S,5S,15R,16R,21R)-18-cyano-1,2,8,8,16,20,20-heptamethyl-13,19-dioxo-12-azapentacyclo[13.8.0.02,11.05,10.016,21]tricos-17-ene-5-carboxylate |
|---|---|
| PubChem CID | 46184213 |
| Molecular Formula | C32H46N2O4 |
| Molecular Weight | 522.73 g/mol |
| Exact Mass | 522.35 |
| IUPAC Name | methyl (1R,2S,5S,15R,16R,21R)-18-cyano-1,2,8,8,16,20,20-heptamethyl-13,19-dioxo-12-azapentacyclo[13.8.0.02,11.05,10.016,21]tricos-17-ene-5-carboxylate |
| SMILES | COC(=O)[C@]12CCC(C)(C)CC1C1NC(=O)C[C@@H]3[C@@]4(C)C=C(C#N)C(=O)C(C)(C)[C@@H]4CC[C@@]3(C)[C@]1(C)CC2 |
| InChI | InChI=1S/C32H46N2O4/c1-27(2)11-13-32(26(37)38-8)14-12-31(7)24(20(32)17-27)34-23(35)15-22-29(5)16-19(18-33)25(36)28(3,4)21(29)9-10-30(22,31)6/h16,20-22,24H,9-15,17H2,1-8H3,(H,34,35)/t20?,21-,22+,24?,29-,30+,31+,32-/m0/s1 |
| InChIKey | HITFTRKLCAUNAN-YNMSPBKVSA-N |
| XLogP | 5.76 |
| TPSA | 96.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.73 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |