C30H41NO5 — CID 144586888
11-cyano-10,14a-dihydroxy-2,2,6b,9,9,12a-hexamethyl-14-oxo-3,4,5,6,6a,7,8,8a,12,14b-decahydro-1H-picene-4a-carboxylic acid (PubChem CID 144586888) has the molecular formula C30H41NO5 and a molecular weight of 495.66 g/mol. Its IUPAC name is 11-cyano-10,14a-dihydroxy-2,2,6b,9,9,12a-hexamethyl-14-oxo-3,4,5,6,6a,7,8,8a,12,14b-decahydro-1H-picene-4a-carboxylic acid.
| Compound Name | 11-cyano-10,14a-dihydroxy-2,2,6b,9,9,12a-hexamethyl-14-oxo-3,4,5,6,6a,7,8,8a,12,14b-decahydro-1H-picene-4a-carboxylic acid |
|---|---|
| PubChem CID | 144586888 |
| Molecular Formula | C30H41NO5 |
| Molecular Weight | 495.66 g/mol |
| Exact Mass | 495.30 |
| IUPAC Name | 11-cyano-10,14a-dihydroxy-2,2,6b,9,9,12a-hexamethyl-14-oxo-3,4,5,6,6a,7,8,8a,12,14b-decahydro-1H-picene-4a-carboxylic acid |
| SMILES | CC1(C)CCC2(C(=O)O)CCC3C4(C)CCC5C(C)(C)C(O)=C(C#N)CC5(C)C4=CC(=O)C3(O)C2C1 |
| InChI | InChI=1S/C30H41NO5/c1-25(2)11-12-29(24(34)35)10-8-19-27(5)9-7-18-26(3,4)23(33)17(16-31)14-28(18,6)20(27)13-22(32)30(19,36)21(29)15-25/h13,18-19,21,33,36H,7-12,14-15H2,1-6H3,(H,34,35) |
| InChIKey | KGESHDKHVWMQEZ-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 118.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.66 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |