C30H44O3 — CID 71556447
(6aR,6bS,8aR,12aS)-2,2,6a,6b,9,9,12a-heptamethyl-10-oxo-3,4,5,6,7,8,8a,11,12,14b-decahydro-1H-picene-4a-carboxylic acid (PubChem CID 71556447) has the molecular formula C30H44O3 and a molecular weight of 452.68 g/mol. Its IUPAC name is (6aR,6bS,8aR,12aS)-2,2,6a,6b,9,9,12a-heptamethyl-10-oxo-3,4,5,6,7,8,8a,11,12,14b-decahydro-1H-picene-4a-carboxylic acid.
| Compound Name | (6aR,6bS,8aR,12aS)-2,2,6a,6b,9,9,12a-heptamethyl-10-oxo-3,4,5,6,7,8,8a,11,12,14b-decahydro-1H-picene-4a-carboxylic acid |
|---|---|
| PubChem CID | 71556447 |
| Molecular Formula | C30H44O3 |
| Molecular Weight | 452.68 g/mol |
| Exact Mass | 452.33 |
| IUPAC Name | (6aR,6bS,8aR,12aS)-2,2,6a,6b,9,9,12a-heptamethyl-10-oxo-3,4,5,6,7,8,8a,11,12,14b-decahydro-1H-picene-4a-carboxylic acid |
| SMILES | CC1(C)CCC2(C(=O)O)CC[C@]3(C)C(=CC=C4[C@@]5(C)CCC(=O)C(C)(C)[C@@H]5CC[C@]43C)C2C1 |
| InChI | InChI=1S/C30H44O3/c1-25(2)14-16-30(24(32)33)17-15-28(6)19(20(30)18-25)8-9-22-27(5)12-11-23(31)26(3,4)21(27)10-13-29(22,28)7/h8-9,20-21H,10-18H2,1-7H3,(H,32,33)/t20?,21-,27-,28+,29+,30?/m0/s1 |
| InChIKey | TXUPJCVPEGVTHF-DGICZGJWSA-N |
| XLogP | 7.36 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.68 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |