C18H26O3 — CID 21084650
(4aR,8aR,10aS)-1,1,4a-trimethyl-2-oxo-3,4,6,7,8,9,10,10a-octahydrophenanthrene-8a-carboxylic acid (PubChem CID 21084650) has the molecular formula C18H26O3 and a molecular weight of 290.40 g/mol. Its IUPAC name is (4aR,8aR,10aS)-1,1,4a-trimethyl-2-oxo-3,4,6,7,8,9,10,10a-octahydrophenanthrene-8a-carboxylic acid.
| Compound Name | (4aR,8aR,10aS)-1,1,4a-trimethyl-2-oxo-3,4,6,7,8,9,10,10a-octahydrophenanthrene-8a-carboxylic acid |
|---|---|
| PubChem CID | 21084650 |
| Molecular Formula | C18H26O3 |
| Molecular Weight | 290.40 g/mol |
| Exact Mass | 290.19 |
| IUPAC Name | (4aR,8aR,10aS)-1,1,4a-trimethyl-2-oxo-3,4,6,7,8,9,10,10a-octahydrophenanthrene-8a-carboxylic acid |
| SMILES | CC1(C)C(=O)CC[C@@]2(C)C3=CCCC[C@@]3(C(=O)O)CC[C@H]12 |
| InChI | InChI=1S/C18H26O3/c1-16(2)12-7-11-18(15(20)21)9-5-4-6-13(18)17(12,3)10-8-14(16)19/h6,12H,4-5,7-11H2,1-3H3,(H,20,21)/t12-,17-,18-/m1/s1 |
| InChIKey | FLHKVLMQNSGOAQ-NXOUGTEYSA-N |
| XLogP | 3.97 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.40 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|