C19H24O2 — CID 75631166
8a-ethynyl-1,1,4a-trimethyl-4,7,8,9,10,10a-hexahydro-3H-phenanthrene-2,6-dione (PubChem CID 75631166) has the molecular formula C19H24O2 and a molecular weight of 284.40 g/mol. Its IUPAC name is 8a-ethynyl-1,1,4a-trimethyl-4,7,8,9,10,10a-hexahydro-3H-phenanthrene-2,6-dione.
| Compound Name | 8a-ethynyl-1,1,4a-trimethyl-4,7,8,9,10,10a-hexahydro-3H-phenanthrene-2,6-dione |
|---|---|
| PubChem CID | 75631166 |
| Molecular Formula | C19H24O2 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.18 |
| IUPAC Name | 8a-ethynyl-1,1,4a-trimethyl-4,7,8,9,10,10a-hexahydro-3H-phenanthrene-2,6-dione |
| SMILES | C#CC12CCC(=O)C=C1C1(C)CCC(=O)C(C)(C)C1CC2 |
| InChI | InChI=1S/C19H24O2/c1-5-19-10-6-13(20)12-15(19)18(4)9-8-16(21)17(2,3)14(18)7-11-19/h1,12,14H,6-11H2,2-4H3 |
| InChIKey | RYCKKVSJKKEGFF-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|