C24H32O2Si — CID 163710379
(4aS,8aS)-1,1,4a-trimethyl-8a-(4-trimethylsilylbuta-1,3-diynyl)-4,7,8,9,10,10a-hexahydro-3H-phenanthrene-2,6-dione (PubChem CID 163710379) has the molecular formula C24H32O2Si and a molecular weight of 380.60 g/mol. Its IUPAC name is (4aS,8aS)-1,1,4a-trimethyl-8a-(4-trimethylsilylbuta-1,3-diynyl)-4,7,8,9,10,10a-hexahydro-3H-phenanthrene-2,6-dione.
| Compound Name | (4aS,8aS)-1,1,4a-trimethyl-8a-(4-trimethylsilylbuta-1,3-diynyl)-4,7,8,9,10,10a-hexahydro-3H-phenanthrene-2,6-dione |
|---|---|
| PubChem CID | 163710379 |
| Molecular Formula | C24H32O2Si |
| Molecular Weight | 380.60 g/mol |
| Exact Mass | 380.22 |
| IUPAC Name | (4aS,8aS)-1,1,4a-trimethyl-8a-(4-trimethylsilylbuta-1,3-diynyl)-4,7,8,9,10,10a-hexahydro-3H-phenanthrene-2,6-dione |
| SMILES | CC1(C)C(=O)CC[C@]2(C)C3=CC(=O)CC[C@]3(C#CC#C[Si](C)(C)C)CCC12 |
| InChI | InChI=1S/C24H32O2Si/c1-22(2)19-10-15-24(12-7-8-16-27(4,5)6)14-9-18(25)17-20(24)23(19,3)13-11-21(22)26/h17,19H,9-11,13-15H2,1-6H3/t19?,23-,24+/m0/s1 |
| InChIKey | KIRYIVRRGWJHJI-ZJWHSJSFSA-N |
| XLogP | 4.95 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.60 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|