C19H22N2O2 — CID 58802222
(4aR,6aR,11aS)-7,7,11a-trimethyl-2-oxo-3,4,5,6,6a,11-hexahydronaphtho[1,2-f][1,2]benzoxazole-4a-carbonitrile (PubChem CID 58802222) has the molecular formula C19H22N2O2 and a molecular weight of 310.40 g/mol. Its IUPAC name is (4aR,6aR,11aS)-7,7,11a-trimethyl-2-oxo-3,4,5,6,6a,11-hexahydronaphtho[1,2-f][1,2]benzoxazole-4a-carbonitrile.
| Compound Name | (4aR,6aR,11aS)-7,7,11a-trimethyl-2-oxo-3,4,5,6,6a,11-hexahydronaphtho[1,2-f][1,2]benzoxazole-4a-carbonitrile |
|---|---|
| PubChem CID | 58802222 |
| Molecular Formula | C19H22N2O2 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | (4aR,6aR,11aS)-7,7,11a-trimethyl-2-oxo-3,4,5,6,6a,11-hexahydronaphtho[1,2-f][1,2]benzoxazole-4a-carbonitrile |
| SMILES | CC1(C)c2oncc2C[C@]2(C)C3=CC(=O)CC[C@]3(C#N)CC[C@@H]12 |
| InChI | InChI=1S/C19H22N2O2/c1-17(2)14-5-7-19(11-20)6-4-13(22)8-15(19)18(14,3)9-12-10-21-23-16(12)17/h8,10,14H,4-7,9H2,1-3H3/t14-,18-,19+/m0/s1 |
| InChIKey | CYXSETUDZIZRAG-ZOCIIQOWSA-N |
| XLogP | 3.72 |
| TPSA | 66.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |