C21H27NO3 — CID 10903966
methyl (4aS,6aR,11aS)-4a,7,7,11a-tetramethyl-5,6,6a,11-tetrahydro-2H-naphtho[1,2-f][1,2]benzoxazole-3-carboxylate (PubChem CID 10903966) has the molecular formula C21H27NO3 and a molecular weight of 341.45 g/mol. Its IUPAC name is methyl (4aS,6aR,11aS)-4a,7,7,11a-tetramethyl-5,6,6a,11-tetrahydro-2H-naphtho[1,2-f][1,2]benzoxazole-3-carboxylate.
| Compound Name | methyl (4aS,6aR,11aS)-4a,7,7,11a-tetramethyl-5,6,6a,11-tetrahydro-2H-naphtho[1,2-f][1,2]benzoxazole-3-carboxylate |
|---|---|
| PubChem CID | 10903966 |
| Molecular Formula | C21H27NO3 |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.20 |
| IUPAC Name | methyl (4aS,6aR,11aS)-4a,7,7,11a-tetramethyl-5,6,6a,11-tetrahydro-2H-naphtho[1,2-f][1,2]benzoxazole-3-carboxylate |
| SMILES | COC(=O)C1=C[C@]2(C)CC[C@H]3C(C)(C)c4oncc4C[C@]3(C)C2=CC1 |
| InChI | InChI=1S/C21H27NO3/c1-19(2)15-8-9-20(3)10-13(18(23)24-5)6-7-16(20)21(15,4)11-14-12-22-25-17(14)19/h7,10,12,15H,6,8-9,11H2,1-5H3/t15-,20-,21-/m0/s1 |
| InChIKey | DNJQAGYAGSMLJX-JHVJFLLYSA-N |
| XLogP | 4.36 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|