C30H45N3O2 — CID 171454364
(1S,2R,5S,8R,9S,10S,11R,15S,23R)-5-hydrazinyl-1,2,8,9,15,22,22-heptamethyl-20-oxa-19-azahexacyclo[12.11.0.02,11.05,10.015,23.017,21]pentacosa-13,17(21),18-trien-12-one (PubChem CID 171454364) has the molecular formula C30H45N3O2 and a molecular weight of 479.71 g/mol. Its IUPAC name is (1S,2R,5S,8R,9S,10S,11R,15S,23R)-5-hydrazinyl-1,2,8,9,15,22,22-heptamethyl-20-oxa-19-azahexacyclo[12.11.0.02,11.05,10.015,23.017,21]pentacosa-13,17(21),18-trien-12-one.
| Compound Name | (1S,2R,5S,8R,9S,10S,11R,15S,23R)-5-hydrazinyl-1,2,8,9,15,22,22-heptamethyl-20-oxa-19-azahexacyclo[12.11.0.02,11.05,10.015,23.017,21]pentacosa-13,17(21),18-trien-12-one |
|---|---|
| PubChem CID | 171454364 |
| Molecular Formula | C30H45N3O2 |
| Molecular Weight | 479.71 g/mol |
| Exact Mass | 479.35 |
| IUPAC Name | (1S,2R,5S,8R,9S,10S,11R,15S,23R)-5-hydrazinyl-1,2,8,9,15,22,22-heptamethyl-20-oxa-19-azahexacyclo[12.11.0.02,11.05,10.015,23.017,21]pentacosa-13,17(21),18-trien-12-one |
| SMILES | C[C@@H]1[C@H]2[C@H]3C(=O)C=C4[C@@]5(C)Cc6cnoc6C(C)(C)[C@@H]5CC[C@@]4(C)[C@]3(C)CC[C@@]2(NN)CC[C@H]1C |
| InChI | InChI=1S/C30H45N3O2/c1-17-8-11-30(33-31)13-12-29(7)24(23(30)18(17)2)20(34)14-22-27(5)15-19-16-32-35-25(19)26(3,4)21(27)9-10-28(22,29)6/h14,16-18,21,23-24,33H,8-13,15,31H2,1-7H3/t17-,18+,21+,23+,24-,27+,28-,29-,30+/m1/s1 |
| InChIKey | OHFXOQHXWQEBFV-DSBPZZANSA-N |
| XLogP | 5.74 |
| TPSA | 81.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.71 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|